C8HF17O2 — CID 97290986
(2S)-1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-[(1R)-1,2,2,2-tetrafluoroethoxy]propane (PubChem CID 97290986) has the molecular formula C8HF17O2 and a molecular weight of 452.06 g/mol. Its IUPAC name is (2S)-1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-[(1R)-1,2,2,2-tetrafluoroethoxy]propane.
| Compound Name | (2S)-1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-[(1R)-1,2,2,2-tetrafluoroethoxy]propane |
|---|---|
| PubChem CID | 97290986 |
| Molecular Formula | C8HF17O2 |
| Molecular Weight | 452.06 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | (2S)-1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-[(1R)-1,2,2,2-tetrafluoroethoxy]propane |
| SMILES | F[C@@H](OC(F)(F)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8HF17O2/c9-1(2(10,11)12)26-8(24,25)4(15,6(19,20)21)27-7(22,23)3(13,14)5(16,17)18/h1H/t1-,4-/m0/s1 |
| InChIKey | PYSYKOPZHYNYSZ-KQVAGGMYSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.06 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|