C9H12ClF6O3P — CID 97291462
(2R,6R)-6-tert-butyl-2-chloro-4,4-bis(trifluoromethyl)-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 97291462) has the molecular formula C9H12ClF6O3P and a molecular weight of 348.61 g/mol. Its IUPAC name is (2R,6R)-6-tert-butyl-2-chloro-4,4-bis(trifluoromethyl)-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | (2R,6R)-6-tert-butyl-2-chloro-4,4-bis(trifluoromethyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 97291462 |
| Molecular Formula | C9H12ClF6O3P |
| Molecular Weight | 348.61 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | (2R,6R)-6-tert-butyl-2-chloro-4,4-bis(trifluoromethyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CC(C)(C)[C@H]1CC(C(F)(F)F)(C(F)(F)F)O[P@](=O)(Cl)O1 |
| InChI | InChI=1S/C9H12ClF6O3P/c1-6(2,3)5-4-7(8(11,12)13,9(14,15)16)19-20(10,17)18-5/h5H,4H2,1-3H3/t5-,20+/m1/s1 |
| InChIKey | OFNLVYSEXFAWSB-IXMBBWDASA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|