C4H2Br2F6 — CID 97291901
(2S,3S)-2,3-dibromo-1,1,1,4,4,4-hexafluorobutane (PubChem CID 97291901) has the molecular formula C4H2Br2F6 and a molecular weight of 323.86 g/mol. Its IUPAC name is (2S,3S)-2,3-dibromo-1,1,1,4,4,4-hexafluorobutane.
| Compound Name | (2S,3S)-2,3-dibromo-1,1,1,4,4,4-hexafluorobutane |
|---|---|
| PubChem CID | 97291901 |
| Molecular Formula | C4H2Br2F6 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 321.84 |
| IUPAC Name | (2S,3S)-2,3-dibromo-1,1,1,4,4,4-hexafluorobutane |
| SMILES | FC(F)(F)[C@H](Br)[C@@H](Br)C(F)(F)F |
| InChI | InChI=1S/C4H2Br2F6/c5-1(3(7,8)9)2(6)4(10,11)12/h1-2H/t1-,2-/m1/s1 |
| InChIKey | CLDAABVXWZWULA-JCYAYHJZSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|