C5H2F10 — CID 97292223
(3S,4R)-1,1,1,2,2,3,4,5,5,5-decafluoropentane (PubChem CID 97292223) has the molecular formula C5H2F10 and a molecular weight of 252.05 g/mol. Its IUPAC name is (3S,4R)-1,1,1,2,2,3,4,5,5,5-decafluoropentane.
| Compound Name | (3S,4R)-1,1,1,2,2,3,4,5,5,5-decafluoropentane |
|---|---|
| PubChem CID | 97292223 |
| Molecular Formula | C5H2F10 |
| Molecular Weight | 252.05 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | (3S,4R)-1,1,1,2,2,3,4,5,5,5-decafluoropentane |
| SMILES | F[C@H]([C@H](F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F10/c6-1(2(7)4(10,11)12)3(8,9)5(13,14)15/h1-2H/t1-,2+/m0/s1 |
| InChIKey | RIQRGMUSBYGDBL-NHYDCYSISA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.05 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|