C5H8Br4 — CID 97292402
(2R,3R,4S)-1,2,3,4-tetrabromopentane (PubChem CID 97292402) has the molecular formula C5H8Br4 and a molecular weight of 387.74 g/mol. Its IUPAC name is (2R,3R,4S)-1,2,3,4-tetrabromopentane.
| Compound Name | (2R,3R,4S)-1,2,3,4-tetrabromopentane |
|---|---|
| PubChem CID | 97292402 |
| Molecular Formula | C5H8Br4 |
| Molecular Weight | 387.74 g/mol |
| Exact Mass | 383.74 |
| IUPAC Name | (2R,3R,4S)-1,2,3,4-tetrabromopentane |
| SMILES | C[C@H](Br)[C@@H](Br)[C@H](Br)CBr |
| InChI | InChI=1S/C5H8Br4/c1-3(7)5(9)4(8)2-6/h3-5H,2H2,1H3/t3-,4+,5+/m0/s1 |
| InChIKey | NALIDLUWYFOKFM-VPENINKCSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|