About 7-methyl-6H-indole
7-methyl-6H-indole (PubChem CID 97295156) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 7-methyl-6H-indole.
Molecular Properties
| Compound Name | 7-methyl-6H-indole |
| PubChem CID | 97295156 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 7-methyl-6H-indole |
| SMILES | CC1=C2N=CC=C2C=CC1 |
| InChI | InChI=1S/C9H9N/c1-7-3-2-4-8-5-6-10-9(7)8/h2,4-6H,3H2,1H3 |
| InChIKey | LTPMITNWSAIEIF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methyl-6H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6H-indole?
The IUPAC name of 7-methyl-6H-indole (CID 97295156) is 7-methyl-6H-indole.
What is the SMILES notation for 7-methyl-6H-indole?
The canonical SMILES for 7-methyl-6H-indole is CC1=C2N=CC=C2C=CC1.
What is the InChIKey of 7-methyl-6H-indole?
The InChIKey is LTPMITNWSAIEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-7-3-2-4-8-5-6-10-9(7)8/h2,4-6H,3H2,1H3.
What are the key properties of 7-methyl-6H-indole?
7-methyl-6H-indole has a molecular weight of 131.18 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6H-indole is sourced from PubChem (CID 97295156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).