C20H14N2O6 — CID 97295477
[(3aR,4S,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 2-phenoxypyridine-3-carboxylate (PubChem CID 97295477) has the molecular formula C20H14N2O6 and a molecular weight of 378.34 g/mol. Its IUPAC name is [(3aR,4S,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 2-phenoxypyridine-3-carboxylate.
| Compound Name | [(3aR,4S,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 2-phenoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 97295477 |
| Molecular Formula | C20H14N2O6 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [(3aR,4S,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 2-phenoxypyridine-3-carboxylate |
| SMILES | O=C(ON1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@@H]2O1)c1cccnc1Oc1ccccc1 |
| InChI | InChI=1S/C20H14N2O6/c23-18-15-13-8-9-14(27-13)16(15)19(24)22(18)28-20(25)12-7-4-10-21-17(12)26-11-5-2-1-3-6-11/h1-10,13-16H/t13-,14+,15-,16-/m0/s1 |
| InChIKey | CGKUMULTCAAZHU-FZKCQIBNSA-N |
| XLogP | 1.88 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|