C18H19N3O2S — CID 972956
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-pyridin-4-yl-1,3-thiazol-2-amine (PubChem CID 972956) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-pyridin-4-yl-1,3-thiazol-2-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-pyridin-4-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 972956 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-pyridin-4-yl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(CCNc2nc(-c3ccncc3)cs2)cc1OC |
| InChI | InChI=1S/C18H19N3O2S/c1-22-16-4-3-13(11-17(16)23-2)5-10-20-18-21-15(12-24-18)14-6-8-19-9-7-14/h3-4,6-9,11-12H,5,10H2,1-2H3,(H,20,21) |
| InChIKey | WZIHWUONKFTQRZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |