About [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate
[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate (PubChem CID 972962) has the molecular formula C19H17NO5
and a molecular weight of 339.35 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate.
Molecular Properties
| Compound Name | [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate |
| PubChem CID | 972962 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(N3C(=O)CCC3=O)c(C)c2)c1 |
| InChI | InChI=1S/C19H17NO5/c1-12-10-15(6-7-16(12)20-17(21)8-9-18(20)22)25-19(23)13-4-3-5-14(11-13)24-2/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | BQGLGWCJTINBQO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate?
The IUPAC name of [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate (CID 972962) is [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate.
What is the SMILES notation for [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate?
The canonical SMILES for [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate is COc1cccc(C(=O)Oc2ccc(N3C(=O)CCC3=O)c(C)c2)c1.
What is the InChIKey of [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate?
The InChIKey is BQGLGWCJTINBQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5/c1-12-10-15(6-7-16(12)20-17(21)8-9-18(20)22)25-19(23)13-4-3-5-14(11-13)24-2/h3-7,10-11H,8-9H2,1-2H3.
What are the key properties of [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate?
[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate has a molecular weight of 339.35 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 3-methoxybenzoate is sourced from PubChem (CID 972962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).