About 2-[(1R)-2,2-difluorocyclopropyl]ethanamine
2-[(1R)-2,2-difluorocyclopropyl]ethanamine (PubChem CID 97296634) has the molecular formula C5H9F2N
and a molecular weight of 121.13 g/mol. Its IUPAC name is 2-[(1R)-2,2-difluorocyclopropyl]ethanamine.
Molecular Properties
| Compound Name | 2-[(1R)-2,2-difluorocyclopropyl]ethanamine |
| PubChem CID | 97296634 |
| Molecular Formula | C5H9F2N |
| Molecular Weight | 121.13 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | 2-[(1R)-2,2-difluorocyclopropyl]ethanamine |
| SMILES | NCC[C@@H]1CC1(F)F |
| InChI | InChI=1S/C5H9F2N/c6-5(7)3-4(5)1-2-8/h4H,1-3,8H2/t4-/m1/s1 |
| InChIKey | JFMDNCKAFKFJTR-SCSAIBSYSA-N |
| XLogP | 0.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.13 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(1R)-2,2-difluorocyclopropyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-2,2-difluorocyclopropyl]ethanamine?
The IUPAC name of 2-[(1R)-2,2-difluorocyclopropyl]ethanamine (CID 97296634) is 2-[(1R)-2,2-difluorocyclopropyl]ethanamine.
What is the SMILES notation for 2-[(1R)-2,2-difluorocyclopropyl]ethanamine?
The canonical SMILES for 2-[(1R)-2,2-difluorocyclopropyl]ethanamine is NCC[C@@H]1CC1(F)F.
What is the InChIKey of 2-[(1R)-2,2-difluorocyclopropyl]ethanamine?
The InChIKey is JFMDNCKAFKFJTR-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H9F2N/c6-5(7)3-4(5)1-2-8/h4H,1-3,8H2/t4-/m1/s1.
What are the key properties of 2-[(1R)-2,2-difluorocyclopropyl]ethanamine?
2-[(1R)-2,2-difluorocyclopropyl]ethanamine has a molecular weight of 121.13 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-2,2-difluorocyclopropyl]ethanamine is sourced from PubChem (CID 97296634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).