C7H13NOS — CID 97297596
[(6R,7aS)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]thiazol-6-yl]methanol (PubChem CID 97297596) has the molecular formula C7H13NOS and a molecular weight of 159.25 g/mol. Its IUPAC name is [(6R,7aS)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]thiazol-6-yl]methanol.
| Compound Name | [(6R,7aS)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]thiazol-6-yl]methanol |
|---|---|
| PubChem CID | 97297596 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | [(6R,7aS)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]thiazol-6-yl]methanol |
| SMILES | OC[C@@H]1C[C@H]2CSCN2C1 |
| InChI | InChI=1S/C7H13NOS/c9-3-6-1-7-4-10-5-8(7)2-6/h6-7,9H,1-5H2/t6-,7+/m1/s1 |
| InChIKey | QBQWMARPHVMZOD-RQJHMYQMSA-N |
| XLogP | 0.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |