C12H19N3 — CID 97297718
(7R)-2-cyclopentyl-4,5,6,7-tetrahydroindazol-7-amine (PubChem CID 97297718) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is (7R)-2-cyclopentyl-4,5,6,7-tetrahydroindazol-7-amine.
| Compound Name | (7R)-2-cyclopentyl-4,5,6,7-tetrahydroindazol-7-amine |
|---|---|
| PubChem CID | 97297718 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (7R)-2-cyclopentyl-4,5,6,7-tetrahydroindazol-7-amine |
| SMILES | N[C@@H]1CCCc2cn(C3CCCC3)nc21 |
| InChI | InChI=1S/C12H19N3/c13-11-7-3-4-9-8-15(14-12(9)11)10-5-1-2-6-10/h8,10-11H,1-7,13H2/t11-/m1/s1 |
| InChIKey | BCHBZNOWZZEHFX-LLVKDONJSA-N |
| XLogP | 2.33 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |