C8H7F5N2O3 — CID 97297901
(3S)-4,4,5,5,5-pentafluoro-3-hydroxy-3-(1H-imidazol-2-yl)pentanoic acid (PubChem CID 97297901) has the molecular formula C8H7F5N2O3 and a molecular weight of 274.14 g/mol. Its IUPAC name is (3S)-4,4,5,5,5-pentafluoro-3-hydroxy-3-(1H-imidazol-2-yl)pentanoic acid.
| Compound Name | (3S)-4,4,5,5,5-pentafluoro-3-hydroxy-3-(1H-imidazol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 97297901 |
| Molecular Formula | C8H7F5N2O3 |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | (3S)-4,4,5,5,5-pentafluoro-3-hydroxy-3-(1H-imidazol-2-yl)pentanoic acid |
| SMILES | O=C(O)C[C@](O)(c1ncc[nH]1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F5N2O3/c9-7(10,8(11,12)13)6(18,3-4(16)17)5-14-1-2-15-5/h1-2,18H,3H2,(H,14,15)(H,16,17)/t6-/m0/s1 |
| InChIKey | QVIGKFWXVZQARN-LURJTMIESA-N |
| XLogP | 1.27 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|