C12H16FN — CID 97297931
(4R)-7-fluoro-2,2,4-trimethyl-3,4-dihydro-1H-quinoline (PubChem CID 97297931) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is (4R)-7-fluoro-2,2,4-trimethyl-3,4-dihydro-1H-quinoline.
| Compound Name | (4R)-7-fluoro-2,2,4-trimethyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 97297931 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (4R)-7-fluoro-2,2,4-trimethyl-3,4-dihydro-1H-quinoline |
| SMILES | C[C@@H]1CC(C)(C)Nc2cc(F)ccc21 |
| InChI | InChI=1S/C12H16FN/c1-8-7-12(2,3)14-11-6-9(13)4-5-10(8)11/h4-6,8,14H,7H2,1-3H3/t8-/m1/s1 |
| InChIKey | YSWZQEZZAZXWAM-MRVPVSSYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |