About N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine
N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine (PubChem CID 972997) has the molecular formula C16H15N3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine |
| PubChem CID | 972997 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(C)c(Nc2nc(-c3cccnc3)cs2)c1 |
| InChI | InChI=1S/C16H15N3S/c1-11-5-6-12(2)14(8-11)18-16-19-15(10-20-16)13-4-3-7-17-9-13/h3-10H,1-2H3,(H,18,19) |
| InChIKey | OEKJPBBWZWSQCJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine?
The IUPAC name of N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine (CID 972997) is N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine.
What is the SMILES notation for N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine?
The canonical SMILES for N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine is Cc1ccc(C)c(Nc2nc(-c3cccnc3)cs2)c1.
What is the InChIKey of N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine?
The InChIKey is OEKJPBBWZWSQCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3S/c1-11-5-6-12(2)14(8-11)18-16-19-15(10-20-16)13-4-3-7-17-9-13/h3-10H,1-2H3,(H,18,19).
What are the key properties of N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine?
N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine has a molecular weight of 281.38 g/mol, XLogP of 4.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 972997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).