C10H13NS — CID 97300354
(3S)-3-methyl-2,3,4,5-tetrahydro-1,4-benzothiazepine (PubChem CID 97300354) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is (3S)-3-methyl-2,3,4,5-tetrahydro-1,4-benzothiazepine.
| Compound Name | (3S)-3-methyl-2,3,4,5-tetrahydro-1,4-benzothiazepine |
|---|---|
| PubChem CID | 97300354 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (3S)-3-methyl-2,3,4,5-tetrahydro-1,4-benzothiazepine |
| SMILES | C[C@H]1CSc2ccccc2CN1 |
| InChI | InChI=1S/C10H13NS/c1-8-7-12-10-5-3-2-4-9(10)6-11-8/h2-5,8,11H,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | VMPYLWXHYKKRNX-QMMMGPOBSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |