About (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol
(2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol (PubChem CID 97300372) has the molecular formula C9H10F3NO
and a molecular weight of 205.18 g/mol. Its IUPAC name is (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol |
| PubChem CID | 97300372 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol |
| SMILES | N[C@](CO)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO/c10-9(11,12)8(13,6-14)7-4-2-1-3-5-7/h1-5,14H,6,13H2/t8-/m1/s1 |
| InChIKey | PUVRUBCEOZTRDR-MRVPVSSYSA-N |
| XLogP | 1.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol?
The IUPAC name of (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol (CID 97300372) is (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol.
What is the SMILES notation for (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol?
The canonical SMILES for (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol is N[C@](CO)(c1ccccc1)C(F)(F)F.
What is the InChIKey of (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol?
The InChIKey is PUVRUBCEOZTRDR-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H10F3NO/c10-9(11,12)8(13,6-14)7-4-2-1-3-5-7/h1-5,14H,6,13H2/t8-/m1/s1.
What are the key properties of (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol?
(2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol has a molecular weight of 205.18 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3,3,3-trifluoro-2-phenylpropan-1-ol is sourced from PubChem (CID 97300372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).