C12H13N3OS — CID 97301341
2-phenyl-5-[(3R)-pyrrolidin-3-yl]sulfanyl-1,3,4-oxadiazole (PubChem CID 97301341) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-phenyl-5-[(3R)-pyrrolidin-3-yl]sulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-phenyl-5-[(3R)-pyrrolidin-3-yl]sulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 97301341 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-phenyl-5-[(3R)-pyrrolidin-3-yl]sulfanyl-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nnc(S[C@@H]3CCNC3)o2)cc1 |
| InChI | InChI=1S/C12H13N3OS/c1-2-4-9(5-3-1)11-14-15-12(16-11)17-10-6-7-13-8-10/h1-5,10,13H,6-8H2/t10-/m1/s1 |
| InChIKey | LVMDRCDQDAJECE-SNVBAGLBSA-N |
| XLogP | 2.19 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |