C14H26O6 — CID 97301592
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(3R)-oct-1-en-3-yl]oxyoxane-3,4,5-triol (PubChem CID 97301592) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(3R)-oct-1-en-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(3R)-oct-1-en-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 97301592 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(3R)-oct-1-en-3-yl]oxyoxane-3,4,5-triol |
| SMILES | C=C[C@@H](CCCCC)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H26O6/c1-3-5-6-7-9(4-2)19-14-13(18)12(17)11(16)10(8-15)20-14/h4,9-18H,2-3,5-8H2,1H3/t9-,10+,11+,12-,13+,14+/m0/s1 |
| InChIKey | MPSRBJBPHXIOFN-GMDXDWKASA-N |
| XLogP | -0.06 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|