C22H29NO — CID 97301987
3-[(1S)-3,3-diethyl-1-phenyl-2-benzofuran-1-yl]-N-methylpropan-1-amine (PubChem CID 97301987) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-[(1S)-3,3-diethyl-1-phenyl-2-benzofuran-1-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[(1S)-3,3-diethyl-1-phenyl-2-benzofuran-1-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 97301987 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 3-[(1S)-3,3-diethyl-1-phenyl-2-benzofuran-1-yl]-N-methylpropan-1-amine |
| SMILES | CCC1(CC)O[C@@](CCCNC)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H29NO/c1-4-21(5-2)19-14-9-10-15-20(19)22(24-21,16-11-17-23-3)18-12-7-6-8-13-18/h6-10,12-15,23H,4-5,11,16-17H2,1-3H3/t22-/m0/s1 |
| InChIKey | YQWNJDDKZBFFJW-QFIPXVFZSA-N |
| XLogP | 4.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|