C11H18 — CID 97302755
(3aS,6aR)-6a-propan-2-yl-2,3,3a,6-tetrahydro-1H-pentalene (PubChem CID 97302755) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (3aS,6aR)-6a-propan-2-yl-2,3,3a,6-tetrahydro-1H-pentalene.
| Compound Name | (3aS,6aR)-6a-propan-2-yl-2,3,3a,6-tetrahydro-1H-pentalene |
|---|---|
| PubChem CID | 97302755 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (3aS,6aR)-6a-propan-2-yl-2,3,3a,6-tetrahydro-1H-pentalene |
| SMILES | CC(C)[C@@]12CC=C[C@@H]1CCC2 |
| InChI | InChI=1S/C11H18/c1-9(2)11-7-3-5-10(11)6-4-8-11/h3,5,9-10H,4,6-8H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | QVXDRNYGHXNQIK-MNOVXSKESA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|