C5H9Br — CID 97302884
cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane (PubChem CID 97302884) has the molecular formula C5H9Br and a molecular weight of 149.03 g/mol. Its IUPAC name is cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane.
| Compound Name | cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane |
|---|---|
| PubChem CID | 97302884 |
| Molecular Formula | C5H9Br |
| Molecular Weight | 149.03 g/mol |
| Exact Mass | 147.99 |
| IUPAC Name | cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane |
| SMILES | C[C@@H]1C(Br)[C@@H]1C |
| InChI | InChI=1S/C5H9Br/c1-3-4(2)5(3)6/h3-5H,1-2H3/t3-,4+,5? |
| InChIKey | ZJKDNNBVHLMMHF-NGQZWQHPSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.03 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|