About cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane
cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane (PubChem CID 97302884) has the molecular formula C5H9Br
and a molecular weight of 149.03 g/mol. Its IUPAC name is cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane.
Molecular Properties
| Compound Name | cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane |
| PubChem CID | 97302884 |
| Molecular Formula | C5H9Br |
| Molecular Weight | 149.03 g/mol |
| Exact Mass | 147.99 |
| IUPAC Name | cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane |
| SMILES | C[C@@H]1C(Br)[C@@H]1C |
| InChI | InChI=1S/C5H9Br/c1-3-4(2)5(3)6/h3-5H,1-2H3/t3-,4+,5? |
| InChIKey | ZJKDNNBVHLMMHF-NGQZWQHPSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.03 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane?
The IUPAC name of cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane (CID 97302884) is cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane.
What is the SMILES notation for cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane?
The canonical SMILES for cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane is C[C@@H]1C(Br)[C@@H]1C.
What is the InChIKey of cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane?
The InChIKey is ZJKDNNBVHLMMHF-NGQZWQHPSA-N. The full InChI is InChI=1S/C5H9Br/c1-3-4(2)5(3)6/h3-5H,1-2H3/t3-,4+,5?.
What are the key properties of cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane?
cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane has a molecular weight of 149.03 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2R,3S)-1-bromo-2,3-dimethylcyclopropane is sourced from PubChem (CID 97302884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).