C19H18Cl2N4O3S — CID 97303240
ethyl 2-[[(E)-2-cyano-3-(2,5-dichloro-3-methylimidazol-4-yl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 97303240) has the molecular formula C19H18Cl2N4O3S and a molecular weight of 453.35 g/mol. Its IUPAC name is ethyl 2-[[(E)-2-cyano-3-(2,5-dichloro-3-methylimidazol-4-yl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-2-cyano-3-(2,5-dichloro-3-methylimidazol-4-yl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 97303240 |
| Molecular Formula | C19H18Cl2N4O3S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | ethyl 2-[[(E)-2-cyano-3-(2,5-dichloro-3-methylimidazol-4-yl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2c(Cl)nc(Cl)n2C)sc2c1CCCC2 |
| InChI | InChI=1S/C19H18Cl2N4O3S/c1-3-28-18(27)14-11-6-4-5-7-13(11)29-17(14)24-16(26)10(9-22)8-12-15(20)23-19(21)25(12)2/h8H,3-7H2,1-2H3,(H,24,26)/b10-8+ |
| InChIKey | QWDFXUGMOOMBAW-CSKARUKUSA-N |
| XLogP | 4.39 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|