C24H21N5O4 — CID 97303561
1-(2-methyl-6-nitrophenyl)-3-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]urea (PubChem CID 97303561) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is 1-(2-methyl-6-nitrophenyl)-3-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]urea.
| Compound Name | 1-(2-methyl-6-nitrophenyl)-3-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]urea |
|---|---|
| PubChem CID | 97303561 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-(2-methyl-6-nitrophenyl)-3-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]urea |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)N[C@@H]1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C24H21N5O4/c1-15-9-8-14-19(29(32)33)20(15)26-24(31)27-22-23(30)28(2)18-13-7-6-12-17(18)21(25-22)16-10-4-3-5-11-16/h3-14,22H,1-2H3,(H2,26,27,31)/t22-/m0/s1 |
| InChIKey | VMGHFEPARZEFKE-QFIPXVFZSA-N |
| XLogP | 3.86 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|