C12H18O2 — CID 97303660
(4aS,8aS)-3-ethoxy-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-one (PubChem CID 97303660) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (4aS,8aS)-3-ethoxy-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-one.
| Compound Name | (4aS,8aS)-3-ethoxy-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 97303660 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (4aS,8aS)-3-ethoxy-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-one |
| SMILES | CCOC1=CC(=O)[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C12H18O2/c1-2-14-10-7-9-5-3-4-6-11(9)12(13)8-10/h8-9,11H,2-7H2,1H3/t9-,11-/m0/s1 |
| InChIKey | RULNUQJXOKMTOG-ONGXEEELSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |