C9H9NO6 — CID 97303727
(1S,2R)-1-methyl-3-nitrocyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 97303727) has the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. Its IUPAC name is (1S,2R)-1-methyl-3-nitrocyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | (1S,2R)-1-methyl-3-nitrocyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 97303727 |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | (1S,2R)-1-methyl-3-nitrocyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | C[C@]1(C(=O)O)C=CC=C([N+](=O)[O-])[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H9NO6/c1-9(8(13)14)4-2-3-5(10(15)16)6(9)7(11)12/h2-4,6H,1H3,(H,11,12)(H,13,14)/t6-,9+/m1/s1 |
| InChIKey | NEZZOQQVQGESBN-MUWHJKNJSA-N |
| XLogP | 0.51 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|