(2S,3S)-2-methoxyoxolane-3-carboxylic acid

C6H10O4 — CID 97303923

IUPAC(2S,3S)-2-methoxyoxolane-3-carboxylic acid
SMILESCO[C@H]1OCC[C@@H]1C(=O)O
InChIInChI=1S/C6H10O4/c1-9-6-4(5(7)8)2-3-10-6/h4,6H,2-3H2,1H3,(H,7,8)/t4-,6+/m1/s1
InChIKeyVVXIZFKICZFWHU-XINAWCOVSA-N
MW146.14 g/mol
LogP0.08
Rot. Bonds2

About (2S,3S)-2-methoxyoxolane-3-carboxylic acid

(2S,3S)-2-methoxyoxolane-3-carboxylic acid (PubChem CID 97303923) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (2S,3S)-2-methoxyoxolane-3-carboxylic acid.

Molecular Properties

Compound Name(2S,3S)-2-methoxyoxolane-3-carboxylic acid
PubChem CID97303923
Molecular FormulaC6H10O4
Molecular Weight146.14 g/mol
Exact Mass146.06
IUPAC Name(2S,3S)-2-methoxyoxolane-3-carboxylic acid
SMILESCO[C@H]1OCC[C@@H]1C(=O)O
InChIInChI=1S/C6H10O4/c1-9-6-4(5(7)8)2-3-10-6/h4,6H,2-3H2,1H3,(H,7,8)/t4-,6+/m1/s1
InChIKeyVVXIZFKICZFWHU-XINAWCOVSA-N
XLogP0.08
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.14
LogP ≤ 50.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2S,3S)-2-methoxyoxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2-methoxyoxolane-3-carboxylic acid?
The IUPAC name of (2S,3S)-2-methoxyoxolane-3-carboxylic acid (CID 97303923) is (2S,3S)-2-methoxyoxolane-3-carboxylic acid.
What is the SMILES notation for (2S,3S)-2-methoxyoxolane-3-carboxylic acid?
The canonical SMILES for (2S,3S)-2-methoxyoxolane-3-carboxylic acid is CO[C@H]1OCC[C@@H]1C(=O)O.
What is the InChIKey of (2S,3S)-2-methoxyoxolane-3-carboxylic acid?
The InChIKey is VVXIZFKICZFWHU-XINAWCOVSA-N. The full InChI is InChI=1S/C6H10O4/c1-9-6-4(5(7)8)2-3-10-6/h4,6H,2-3H2,1H3,(H,7,8)/t4-,6+/m1/s1.
What are the key properties of (2S,3S)-2-methoxyoxolane-3-carboxylic acid?
(2S,3S)-2-methoxyoxolane-3-carboxylic acid has a molecular weight of 146.14 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-methoxyoxolane-3-carboxylic acid is sourced from PubChem (CID 97303923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).