About (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid
(1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 97304050) has the molecular formula C7H5ClN2O6S
and a molecular weight of 280.65 g/mol. Its IUPAC name is (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 97304050 |
| Molecular Formula | C7H5ClN2O6S |
| Molecular Weight | 280.65 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | NC1=C[C@H](C(=O)O)C(=S(=O)=O)C([N+](=O)[O-])=C1Cl |
| InChI | InChI=1S/C7H5ClN2O6S/c8-4-3(9)1-2(7(11)12)6(17(15)16)5(4)10(13)14/h1-2H,9H2,(H,11,12)/t2-/m0/s1 |
| InChIKey | GBQOGOGKLFWAFM-REOHCLBHSA-N |
| XLogP | -0.68 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.65 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid (CID 97304050) is (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid is NC1=C[C@H](C(=O)O)C(=S(=O)=O)C([N+](=O)[O-])=C1Cl.
What is the InChIKey of (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is GBQOGOGKLFWAFM-REOHCLBHSA-N. The full InChI is InChI=1S/C7H5ClN2O6S/c8-4-3(9)1-2(7(11)12)6(17(15)16)5(4)10(13)14/h1-2H,9H2,(H,11,12)/t2-/m0/s1.
What are the key properties of (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
(1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 280.65 g/mol, XLogP of -0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-amino-4-chloro-5-nitro-6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 97304050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).