About [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate
[(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate (PubChem CID 97304354) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate |
| PubChem CID | 97304354 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate |
| SMILES | CC[C@@H]1CC[C@H](OC(=O)c2cn[nH]c2)C1 |
| InChI | InChI=1S/C11H16N2O2/c1-2-8-3-4-10(5-8)15-11(14)9-6-12-13-7-9/h6-8,10H,2-5H2,1H3,(H,12,13)/t8-,10+/m1/s1 |
| InChIKey | GFWVVYJXMFPAHH-SCZZXKLOSA-N |
| XLogP | 2.15 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate?
The IUPAC name of [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate (CID 97304354) is [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate.
What is the SMILES notation for [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate?
The canonical SMILES for [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate is CC[C@@H]1CC[C@H](OC(=O)c2cn[nH]c2)C1.
What is the InChIKey of [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate?
The InChIKey is GFWVVYJXMFPAHH-SCZZXKLOSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-2-8-3-4-10(5-8)15-11(14)9-6-12-13-7-9/h6-8,10H,2-5H2,1H3,(H,12,13)/t8-,10+/m1/s1.
What are the key properties of [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate?
[(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate has a molecular weight of 208.26 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-3-ethylcyclopentyl] 1H-pyrazole-4-carboxylate is sourced from PubChem (CID 97304354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).