C8H16ClN — CID 97304641
2-[(1R,2S)-2-chlorocyclohexyl]ethanamine (PubChem CID 97304641) has the molecular formula C8H16ClN and a molecular weight of 161.68 g/mol. Its IUPAC name is 2-[(1R,2S)-2-chlorocyclohexyl]ethanamine.
| Compound Name | 2-[(1R,2S)-2-chlorocyclohexyl]ethanamine |
|---|---|
| PubChem CID | 97304641 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-[(1R,2S)-2-chlorocyclohexyl]ethanamine |
| SMILES | NCC[C@H]1CCCC[C@@H]1Cl |
| InChI | InChI=1S/C8H16ClN/c9-8-4-2-1-3-7(8)5-6-10/h7-8H,1-6,10H2/t7-,8+/m1/s1 |
| InChIKey | NFNYPWPUGNRIQE-SFYZADRCSA-N |
| XLogP | 2.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|