About tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate
tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate (PubChem CID 97305562) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate |
| PubChem CID | 97305562 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate |
| SMILES | CC(C)(C)OC(=O)[C@@H](O)c1[nH]nc2ncccc12 |
| InChI | InChI=1S/C12H15N3O3/c1-12(2,3)18-11(17)9(16)8-7-5-4-6-13-10(7)15-14-8/h4-6,9,16H,1-3H3,(H,13,14,15)/t9-/m0/s1 |
| InChIKey | OPQDSAOSAAMEJD-VIFPVBQESA-N |
| XLogP | 1.33 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate?
The IUPAC name of tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate (CID 97305562) is tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate.
What is the SMILES notation for tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate?
The canonical SMILES for tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate is CC(C)(C)OC(=O)[C@@H](O)c1[nH]nc2ncccc12.
What is the InChIKey of tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate?
The InChIKey is OPQDSAOSAAMEJD-VIFPVBQESA-N. The full InChI is InChI=1S/C12H15N3O3/c1-12(2,3)18-11(17)9(16)8-7-5-4-6-13-10(7)15-14-8/h4-6,9,16H,1-3H3,(H,13,14,15)/t9-/m0/s1.
What are the key properties of tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate?
tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate has a molecular weight of 249.27 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-hydroxy-2-(2H-pyrazolo[3,4-b]pyridin-3-yl)acetate is sourced from PubChem (CID 97305562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).