About 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea
1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea (PubChem CID 97306096) has the molecular formula C12H22N2O3S2
and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea.
Molecular Properties
| Compound Name | 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea |
| PubChem CID | 97306096 |
| Molecular Formula | C12H22N2O3S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea |
| SMILES | C[C@]1(CNC(=O)N[C@@H]2CCCS(=O)(=O)C2)CCCS1 |
| InChI | InChI=1S/C12H22N2O3S2/c1-12(5-3-6-18-12)9-13-11(15)14-10-4-2-7-19(16,17)8-10/h10H,2-9H2,1H3,(H2,13,14,15)/t10-,12-/m1/s1 |
| InChIKey | VTYRAQBFKRPTBA-ZYHUDNBSSA-N |
| XLogP | 1.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea?
The IUPAC name of 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea (CID 97306096) is 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea.
What is the SMILES notation for 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea?
The canonical SMILES for 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea is C[C@]1(CNC(=O)N[C@@H]2CCCS(=O)(=O)C2)CCCS1.
What is the InChIKey of 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea?
The InChIKey is VTYRAQBFKRPTBA-ZYHUDNBSSA-N. The full InChI is InChI=1S/C12H22N2O3S2/c1-12(5-3-6-18-12)9-13-11(15)14-10-4-2-7-19(16,17)8-10/h10H,2-9H2,1H3,(H2,13,14,15)/t10-,12-/m1/s1.
What are the key properties of 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea?
1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea has a molecular weight of 306.45 g/mol, XLogP of 1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-1,1-dioxothian-3-yl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea is sourced from PubChem (CID 97306096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).