C11H25NO2 — CID 97307244
(2S,3R)-3-(5-methoxypentylamino)-2-methylbutan-1-ol (PubChem CID 97307244) has the molecular formula C11H25NO2 and a molecular weight of 203.33 g/mol. Its IUPAC name is (2S,3R)-3-(5-methoxypentylamino)-2-methylbutan-1-ol.
| Compound Name | (2S,3R)-3-(5-methoxypentylamino)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 97307244 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | (2S,3R)-3-(5-methoxypentylamino)-2-methylbutan-1-ol |
| SMILES | COCCCCCN[C@H](C)[C@H](C)CO |
| InChI | InChI=1S/C11H25NO2/c1-10(9-13)11(2)12-7-5-4-6-8-14-3/h10-13H,4-9H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | YDTLSCPIBFAYMI-GHMZBOCLSA-N |
| XLogP | 1.41 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|