C13H22N2O2 — CID 97308157
1-cyclohexyl-1-[(2R)-2-hydroxypropyl]-3-prop-2-ynylurea (PubChem CID 97308157) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-cyclohexyl-1-[(2R)-2-hydroxypropyl]-3-prop-2-ynylurea.
| Compound Name | 1-cyclohexyl-1-[(2R)-2-hydroxypropyl]-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 97308157 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-cyclohexyl-1-[(2R)-2-hydroxypropyl]-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)N(C[C@@H](C)O)C1CCCCC1 |
| InChI | InChI=1S/C13H22N2O2/c1-3-9-14-13(17)15(10-11(2)16)12-7-5-4-6-8-12/h1,11-12,16H,4-10H2,2H3,(H,14,17)/t11-/m1/s1 |
| InChIKey | ORWXLQBYOJYXPO-LLVKDONJSA-N |
| XLogP | 1.34 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|