C11H20N2O3 — CID 97308195
1-[(1R,2S,3S)-3-ethoxy-2-methoxycyclobutyl]-3-prop-2-enylurea (PubChem CID 97308195) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-[(1R,2S,3S)-3-ethoxy-2-methoxycyclobutyl]-3-prop-2-enylurea.
| Compound Name | 1-[(1R,2S,3S)-3-ethoxy-2-methoxycyclobutyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 97308195 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-[(1R,2S,3S)-3-ethoxy-2-methoxycyclobutyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)N[C@@H]1C[C@H](OCC)[C@H]1OC |
| InChI | InChI=1S/C11H20N2O3/c1-4-6-12-11(14)13-8-7-9(16-5-2)10(8)15-3/h4,8-10H,1,5-7H2,2-3H3,(H2,12,13,14)/t8-,9+,10+/m1/s1 |
| InChIKey | SYBIAHKRMJJRCN-UTLUCORTSA-N |
| XLogP | 0.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|