C16H28N2O2 — CID 97308407
tert-butyl N-[[(2S)-1-pent-3-ynylpiperidin-2-yl]methyl]carbamate (PubChem CID 97308407) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-1-pent-3-ynylpiperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2S)-1-pent-3-ynylpiperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 97308407 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | tert-butyl N-[[(2S)-1-pent-3-ynylpiperidin-2-yl]methyl]carbamate |
| SMILES | CC#CCCN1CCCC[C@H]1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O2/c1-5-6-8-11-18-12-9-7-10-14(18)13-17-15(19)20-16(2,3)4/h14H,7-13H2,1-4H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | ZQMCTAOWCPWTJM-AWEZNQCLSA-N |
| XLogP | 2.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|