C17H28N4OS — CID 97308528
N-[(2S)-4-methylsulfanylbutan-2-yl]-4-[(1S)-1-pyridin-2-ylethyl]piperazine-1-carboxamide (PubChem CID 97308528) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is N-[(2S)-4-methylsulfanylbutan-2-yl]-4-[(1S)-1-pyridin-2-ylethyl]piperazine-1-carboxamide.
| Compound Name | N-[(2S)-4-methylsulfanylbutan-2-yl]-4-[(1S)-1-pyridin-2-ylethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 97308528 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[(2S)-4-methylsulfanylbutan-2-yl]-4-[(1S)-1-pyridin-2-ylethyl]piperazine-1-carboxamide |
| SMILES | CSCC[C@H](C)NC(=O)N1CCN([C@@H](C)c2ccccn2)CC1 |
| InChI | InChI=1S/C17H28N4OS/c1-14(7-13-23-3)19-17(22)21-11-9-20(10-12-21)15(2)16-6-4-5-8-18-16/h4-6,8,14-15H,7,9-13H2,1-3H3,(H,19,22)/t14-,15-/m0/s1 |
| InChIKey | KCQSEQPZHNKPBN-GJZGRUSLSA-N |
| XLogP | 2.61 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |