About tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate
tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate (PubChem CID 97308976) has the molecular formula C13H21Cl2NO4
and a molecular weight of 326.22 g/mol. Its IUPAC name is tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate.
Molecular Properties
| Compound Name | tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate |
| PubChem CID | 97308976 |
| Molecular Formula | C13H21Cl2NO4 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(O)CNC(=O)[C@@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C13H21Cl2NO4/c1-10(2,3)20-9(18)12(5,19)7-16-8(17)11(4)6-13(11,14)15/h19H,6-7H2,1-5H3,(H,16,17)/t11-,12-/m1/s1 |
| InChIKey | AAIXZVUTGAXBNS-VXGBXAGGSA-N |
| XLogP | 1.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate?
The IUPAC name of tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate (CID 97308976) is tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate.
What is the SMILES notation for tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate?
The canonical SMILES for tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate is CC(C)(C)OC(=O)[C@](C)(O)CNC(=O)[C@@]1(C)CC1(Cl)Cl.
What is the InChIKey of tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate?
The InChIKey is AAIXZVUTGAXBNS-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H21Cl2NO4/c1-10(2,3)20-9(18)12(5,19)7-16-8(17)11(4)6-13(11,14)15/h19H,6-7H2,1-5H3,(H,16,17)/t11-,12-/m1/s1.
What are the key properties of tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate?
tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate has a molecular weight of 326.22 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-2-hydroxy-2-methylpropanoate is sourced from PubChem (CID 97308976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).