C16H21N3O4S2 — CID 97309370
4-N-[(2S)-3-methylbutan-2-yl]-1-N-pyridin-4-ylbenzene-1,4-disulfonamide (PubChem CID 97309370) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 4-N-[(2S)-3-methylbutan-2-yl]-1-N-pyridin-4-ylbenzene-1,4-disulfonamide.
| Compound Name | 4-N-[(2S)-3-methylbutan-2-yl]-1-N-pyridin-4-ylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 97309370 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 4-N-[(2S)-3-methylbutan-2-yl]-1-N-pyridin-4-ylbenzene-1,4-disulfonamide |
| SMILES | CC(C)[C@H](C)NS(=O)(=O)c1ccc(S(=O)(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C16H21N3O4S2/c1-12(2)13(3)18-24(20,21)15-4-6-16(7-5-15)25(22,23)19-14-8-10-17-11-9-14/h4-13,18H,1-3H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | DCRPBTVZDACYOM-ZDUSSCGKSA-N |
| XLogP | 2.21 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |