About (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide
(3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide (PubChem CID 97310494) has the molecular formula C14H18N4O2S2
and a molecular weight of 338.46 g/mol. Its IUPAC name is (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide |
| PubChem CID | 97310494 |
| Molecular Formula | C14H18N4O2S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H](N2CCN(c3ncnc4ccsc34)CC2)C1 |
| InChI | InChI=1S/C14H18N4O2S2/c19-22(20)8-2-11(9-22)17-3-5-18(6-4-17)14-13-12(1-7-21-13)15-10-16-14/h1,7,10-11H,2-6,8-9H2/t11-/m1/s1 |
| InChIKey | SHPSUMYPKVYKEO-LLVKDONJSA-N |
| XLogP | 1.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide?
The IUPAC name of (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide (CID 97310494) is (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide.
What is the SMILES notation for (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide?
The canonical SMILES for (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide is O=S1(=O)CC[C@@H](N2CCN(c3ncnc4ccsc34)CC2)C1.
What is the InChIKey of (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide?
The InChIKey is SHPSUMYPKVYKEO-LLVKDONJSA-N. The full InChI is InChI=1S/C14H18N4O2S2/c19-22(20)8-2-11(9-22)17-3-5-18(6-4-17)14-13-12(1-7-21-13)15-10-16-14/h1,7,10-11H,2-6,8-9H2/t11-/m1/s1.
What are the key properties of (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide?
(3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide has a molecular weight of 338.46 g/mol, XLogP of 1.00, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)thiolane 1,1-dioxide is sourced from PubChem (CID 97310494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).