C15H20N2O4 — CID 973111
4-(3,4,5-triethoxyphenyl)-1,2-oxazol-3-amine (PubChem CID 973111) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-(3,4,5-triethoxyphenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(3,4,5-triethoxyphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 973111 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-(3,4,5-triethoxyphenyl)-1,2-oxazol-3-amine |
| SMILES | CCOc1cc(-c2conc2N)cc(OCC)c1OCC |
| InChI | InChI=1S/C15H20N2O4/c1-4-18-12-7-10(11-9-21-17-15(11)16)8-13(19-5-2)14(12)20-6-3/h7-9H,4-6H2,1-3H3,(H2,16,17) |
| InChIKey | JWGKNSFOFGONSD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |