C13H17F3N2O3 — CID 97313698
1-[(2R)-2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 97313698) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-[(2R)-2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-[(2R)-2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 97313698 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[(2R)-2-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | Cc1cc([C@H]2CCCN2C(=O)CCOCC(F)(F)F)on1 |
| InChI | InChI=1S/C13H17F3N2O3/c1-9-7-11(21-17-9)10-3-2-5-18(10)12(19)4-6-20-8-13(14,15)16/h7,10H,2-6,8H2,1H3/t10-/m1/s1 |
| InChIKey | IPFZJHUUSPXSTC-SNVBAGLBSA-N |
| XLogP | 2.62 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|