About (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide
(2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide (PubChem CID 97314450) has the molecular formula C17H23N3O2
and a molecular weight of 301.39 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide.
Molecular Properties
| Compound Name | (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide |
| PubChem CID | 97314450 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide |
| SMILES | Cc1cc(C)n([C@@H](C)C(=O)N(C2CC2)[C@@H](C)c2ccco2)n1 |
| InChI | InChI=1S/C17H23N3O2/c1-11-10-12(2)20(18-11)14(4)17(21)19(15-7-8-15)13(3)16-6-5-9-22-16/h5-6,9-10,13-15H,7-8H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | HBKHADMPBPFLRD-KBPBESRZSA-N |
| XLogP | 3.41 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide?
The IUPAC name of (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide (CID 97314450) is (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide.
What is the SMILES notation for (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide?
The canonical SMILES for (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide is Cc1cc(C)n([C@@H](C)C(=O)N(C2CC2)[C@@H](C)c2ccco2)n1.
What is the InChIKey of (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide?
The InChIKey is HBKHADMPBPFLRD-KBPBESRZSA-N. The full InChI is InChI=1S/C17H23N3O2/c1-11-10-12(2)20(18-11)14(4)17(21)19(15-7-8-15)13(3)16-6-5-9-22-16/h5-6,9-10,13-15H,7-8H2,1-4H3/t13-,14-/m0/s1.
What are the key properties of (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide?
(2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide has a molecular weight of 301.39 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)-N-[(1S)-1-(furan-2-yl)ethyl]propanamide is sourced from PubChem (CID 97314450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).