About [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate
[(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate (PubChem CID 97314627) has the molecular formula C11H15F2N3O3
and a molecular weight of 275.25 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate.
Molecular Properties
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate |
| PubChem CID | 97314627 |
| Molecular Formula | C11H15F2N3O3 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate |
| SMILES | Cc1nn(C(F)F)c(C)c1CC(=O)O[C@H](C)C(N)=O |
| InChI | InChI=1S/C11H15F2N3O3/c1-5-8(6(2)16(15-5)11(12)13)4-9(17)19-7(3)10(14)18/h7,11H,4H2,1-3H3,(H2,14,18)/t7-/m1/s1 |
| InChIKey | CDMIMNDYGNBJBB-SSDOTTSWSA-N |
| XLogP | 0.85 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate?
The IUPAC name of [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate (CID 97314627) is [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate.
What is the SMILES notation for [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate?
The canonical SMILES for [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate is Cc1nn(C(F)F)c(C)c1CC(=O)O[C@H](C)C(N)=O.
What is the InChIKey of [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate?
The InChIKey is CDMIMNDYGNBJBB-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H15F2N3O3/c1-5-8(6(2)16(15-5)11(12)13)4-9(17)19-7(3)10(14)18/h7,11H,4H2,1-3H3,(H2,14,18)/t7-/m1/s1.
What are the key properties of [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate?
[(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate has a molecular weight of 275.25 g/mol, XLogP of 0.85, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-amino-1-oxopropan-2-yl] 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetate is sourced from PubChem (CID 97314627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).