C24H32N2O3 — CID 97316230
tert-butyl (3R)-3-[(1R)-1-[(2-naphthalen-1-ylacetyl)amino]ethyl]piperidine-1-carboxylate (PubChem CID 97316230) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1R)-1-[(2-naphthalen-1-ylacetyl)amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(1R)-1-[(2-naphthalen-1-ylacetyl)amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97316230 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | tert-butyl (3R)-3-[(1R)-1-[(2-naphthalen-1-ylacetyl)amino]ethyl]piperidine-1-carboxylate |
| SMILES | C[C@@H](NC(=O)Cc1cccc2ccccc12)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H32N2O3/c1-17(20-12-8-14-26(16-20)23(28)29-24(2,3)4)25-22(27)15-19-11-7-10-18-9-5-6-13-21(18)19/h5-7,9-11,13,17,20H,8,12,14-16H2,1-4H3,(H,25,27)/t17-,20-/m1/s1 |
| InChIKey | LDBAQJREMNCCAP-YLJYHZDGSA-N |
| XLogP | 4.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |