About N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide
N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 97316377) has the molecular formula C13H22N2OS
and a molecular weight of 254.40 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 97316377 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc(C)c(C(=O)N[C@@H](C)C(C)(C)C)s1 |
| InChI | InChI=1S/C13H22N2OS/c1-7-10-14-8(2)11(17-10)12(16)15-9(3)13(4,5)6/h9H,7H2,1-6H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | RAUPFGZLXFROSN-VIFPVBQESA-N |
| XLogP | 3.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide (CID 97316377) is N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide is CCc1nc(C)c(C(=O)N[C@@H](C)C(C)(C)C)s1.
What is the InChIKey of N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is RAUPFGZLXFROSN-VIFPVBQESA-N. The full InChI is InChI=1S/C13H22N2OS/c1-7-10-14-8(2)11(17-10)12(16)15-9(3)13(4,5)6/h9H,7H2,1-6H3,(H,15,16)/t9-/m0/s1.
What are the key properties of N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide?
N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 254.40 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-3,3-dimethylbutan-2-yl]-2-ethyl-4-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 97316377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).