About 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one
1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one (PubChem CID 97318490) has the molecular formula C19H22N4O
and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one |
| PubChem CID | 97318490 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C[C@H](Nc1ncnc2c1CCC2)c1ccccc1 |
| InChI | InChI=1S/C19H22N4O/c24-18-10-5-11-23(18)12-17(14-6-2-1-3-7-14)22-19-15-8-4-9-16(15)20-13-21-19/h1-3,6-7,13,17H,4-5,8-12H2,(H,20,21,22)/t17-/m0/s1 |
| InChIKey | OZSNFVYQCTYWLY-KRWDZBQOSA-N |
| XLogP | 2.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one?
The IUPAC name of 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one (CID 97318490) is 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one?
The canonical SMILES for 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one is O=C1CCCN1C[C@H](Nc1ncnc2c1CCC2)c1ccccc1.
What is the InChIKey of 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one?
The InChIKey is OZSNFVYQCTYWLY-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H22N4O/c24-18-10-5-11-23(18)12-17(14-6-2-1-3-7-14)22-19-15-8-4-9-16(15)20-13-21-19/h1-3,6-7,13,17H,4-5,8-12H2,(H,20,21,22)/t17-/m0/s1.
What are the key properties of 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one?
1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one has a molecular weight of 322.41 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)-2-phenylethyl]pyrrolidin-2-one is sourced from PubChem (CID 97318490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).