C16H17F2N3O — CID 97318670
1-[3-(difluoromethyl)phenyl]-3-[(1S)-1-pyridin-4-ylpropyl]urea (PubChem CID 97318670) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)phenyl]-3-[(1S)-1-pyridin-4-ylpropyl]urea.
| Compound Name | 1-[3-(difluoromethyl)phenyl]-3-[(1S)-1-pyridin-4-ylpropyl]urea |
|---|---|
| PubChem CID | 97318670 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-[3-(difluoromethyl)phenyl]-3-[(1S)-1-pyridin-4-ylpropyl]urea |
| SMILES | CC[C@H](NC(=O)Nc1cccc(C(F)F)c1)c1ccncc1 |
| InChI | InChI=1S/C16H17F2N3O/c1-2-14(11-6-8-19-9-7-11)21-16(22)20-13-5-3-4-12(10-13)15(17)18/h3-10,14-15H,2H2,1H3,(H2,20,21,22)/t14-/m0/s1 |
| InChIKey | JGSYREFVTCIGOK-AWEZNQCLSA-N |
| XLogP | 4.29 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |