C20H23N3O3 — CID 97319750
N-[5-[[(2R)-2-(2-methylphenoxy)butanoyl]amino]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 97319750) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[5-[[(2R)-2-(2-methylphenoxy)butanoyl]amino]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[5-[[(2R)-2-(2-methylphenoxy)butanoyl]amino]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 97319750 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[5-[[(2R)-2-(2-methylphenoxy)butanoyl]amino]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | CC[C@@H](Oc1ccccc1C)C(=O)Nc1ccc(NC(=O)C2CC2)nc1 |
| InChI | InChI=1S/C20H23N3O3/c1-3-16(26-17-7-5-4-6-13(17)2)20(25)22-15-10-11-18(21-12-15)23-19(24)14-8-9-14/h4-7,10-12,14,16H,3,8-9H2,1-2H3,(H,22,25)(H,21,23,24)/t16-/m1/s1 |
| InChIKey | RAOOXEXJBWPTFX-MRXNPFEDSA-N |
| XLogP | 3.53 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |