About 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea
1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea (PubChem CID 97320456) has the molecular formula C17H23N5OS
and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea |
| PubChem CID | 97320456 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea |
| SMILES | CS[C@H]1CC[C@H](N(C)C(=O)NCc2cn(-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C17H23N5OS/c1-21(15-8-9-16(10-15)24-2)17(23)18-11-13-12-22(20-19-13)14-6-4-3-5-7-14/h3-7,12,15-16H,8-11H2,1-2H3,(H,18,23)/t15-,16-/m0/s1 |
| InChIKey | GUOQUXFKTMLRQG-HOTGVXAUSA-N |
| XLogP | 2.69 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea?
The IUPAC name of 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea (CID 97320456) is 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea.
What is the SMILES notation for 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea?
The canonical SMILES for 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea is CS[C@H]1CC[C@H](N(C)C(=O)NCc2cn(-c3ccccc3)nn2)C1.
What is the InChIKey of 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea?
The InChIKey is GUOQUXFKTMLRQG-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H23N5OS/c1-21(15-8-9-16(10-15)24-2)17(23)18-11-13-12-22(20-19-13)14-6-4-3-5-7-14/h3-7,12,15-16H,8-11H2,1-2H3,(H,18,23)/t15-,16-/m0/s1.
What are the key properties of 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea?
1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea has a molecular weight of 345.47 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-[(1S,3S)-3-methylsulfanylcyclopentyl]-3-[(1-phenyltriazol-4-yl)methyl]urea is sourced from PubChem (CID 97320456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).